ACETIC-D3 ACID, SODIUM SALT
Acetic-d3 acid, sodium salt
CAS: 39230-37-0
Molecular Formula: C2H5NaO2
ACETIC-D3 ACID, SODIUM SALT - Names and Identifiers
| Name | Acetic-d3 acid, sodium salt |
| Synonyms | acetic-D3 acid Sodium acetate-d3 sodium (~2~H_3_)acetate Acetic-d3 acid sodium salt Acetic-d3 acid, sodium salt sodium hydrogen di[2H3]acetate |
| CAS | 39230-37-0 |
| EINECS | 254-366-3 |
| InChI | InChI=1/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1/i1D3 |
ACETIC-D3 ACID, SODIUM SALT - Physico-chemical Properties
| Molecular Formula | C2H5NaO2 |
| Molar Mass | 84.05 |
| Melting Point | >300°C (dec.)(lit.) |
| Boling Point | 117.1°C at 760 mmHg |
| Flash Point | 40°C |
| Vapor Presure | 13.9mmHg at 25°C |
ACETIC-D3 ACID, SODIUM SALT - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 28459000 |
ACETIC-D3 ACID, SODIUM SALT - Introduction
Acetic-d3 acid, sodium salt is a deuterated sodium acetate with the chemical formula CD3COONa. The following is an introduction to the nature, use, formulation and safety information of Acetic-d3 acid, sodium salt:
Nature:
1. appearance: Acetic-d3 acid, sodium salt is generally colorless crystal or white particles.
2. melting point: about 324 ℃.
3. Solubility: Acetic-d3 acid, sodium salt has good solubility and can be dissolved in water and other polar solvents.
Use:
1. labeling agent: Acetic-d3 acid, sodium salt is commonly used as nuclear magnetic resonance (NMR) labeling agent to analyze the structure and reaction mechanism of compounds.
2. other uses: Acetic-d3 acid, sodium salt can also be used in biomedical research and pharmaceutical industry and other fields.
Preparation Method:
Acetic-d3 acid, sodium salt is generally prepared by reacting deuterated acetic acid (CD3COOH) with sodium carbonate (Na2CO3). the reaction will produce Acetic-d3 acid, sodium salt and carbon dioxide (CO2).
Safety Information:
Acetic-d3 acid, sodium salt is relatively stable and safe, but it still needs to take appropriate security measures. When in use, should wear protective glasses and protective gloves, avoid direct contact with skin and mucous membrane. When handling and storing Acetic-d3 acid, sodium salt, care should be taken to avoid contact with oxidants and avoid harmful substances. If taken by mistake or inhaled by mistake, seek medical attention immediately.
Nature:
1. appearance: Acetic-d3 acid, sodium salt is generally colorless crystal or white particles.
2. melting point: about 324 ℃.
3. Solubility: Acetic-d3 acid, sodium salt has good solubility and can be dissolved in water and other polar solvents.
Use:
1. labeling agent: Acetic-d3 acid, sodium salt is commonly used as nuclear magnetic resonance (NMR) labeling agent to analyze the structure and reaction mechanism of compounds.
2. other uses: Acetic-d3 acid, sodium salt can also be used in biomedical research and pharmaceutical industry and other fields.
Preparation Method:
Acetic-d3 acid, sodium salt is generally prepared by reacting deuterated acetic acid (CD3COOH) with sodium carbonate (Na2CO3). the reaction will produce Acetic-d3 acid, sodium salt and carbon dioxide (CO2).
Safety Information:
Acetic-d3 acid, sodium salt is relatively stable and safe, but it still needs to take appropriate security measures. When in use, should wear protective glasses and protective gloves, avoid direct contact with skin and mucous membrane. When handling and storing Acetic-d3 acid, sodium salt, care should be taken to avoid contact with oxidants and avoid harmful substances. If taken by mistake or inhaled by mistake, seek medical attention immediately.
Last Update：2024-04-10 22:29:15
